C28H36N2O4 — CID 170099326
methyl 2-[3-[2-[[4-cyano-4-(4-formyl-3-methoxyphenyl)-5-methylhexyl]-methylamino]ethyl]phenyl]acetate (PubChem CID 170099326) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is methyl 2-[3-[2-[[4-cyano-4-(4-formyl-3-methoxyphenyl)-5-methylhexyl]-methylamino]ethyl]phenyl]acetate.
| Compound Name | methyl 2-[3-[2-[[4-cyano-4-(4-formyl-3-methoxyphenyl)-5-methylhexyl]-methylamino]ethyl]phenyl]acetate |
|---|---|
| PubChem CID | 170099326 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | methyl 2-[3-[2-[[4-cyano-4-(4-formyl-3-methoxyphenyl)-5-methylhexyl]-methylamino]ethyl]phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(CCN(C)CCCC(C#N)(c2ccc(C=O)c(OC)c2)C(C)C)c1 |
| InChI | InChI=1S/C28H36N2O4/c1-21(2)28(20-29,25-11-10-24(19-31)26(18-25)33-4)13-7-14-30(3)15-12-22-8-6-9-23(16-22)17-27(32)34-5/h6,8-11,16,18-19,21H,7,12-15,17H2,1-5H3 |
| InChIKey | IPNJRGDWEHITFV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|