C20H23N3O2 — CID 109027558
3-[2-(1H-indol-3-yl)ethylamino]-N-(2-methoxyphenyl)propanamide (PubChem CID 109027558) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 3-[2-(1H-indol-3-yl)ethylamino]-N-(2-methoxyphenyl)propanamide.
| Compound Name | 3-[2-(1H-indol-3-yl)ethylamino]-N-(2-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 109027558 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 3-[2-(1H-indol-3-yl)ethylamino]-N-(2-methoxyphenyl)propanamide |
| SMILES | COc1ccccc1NC(=O)CCNCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H23N3O2/c1-25-19-9-5-4-8-18(19)23-20(24)11-13-21-12-10-15-14-22-17-7-3-2-6-16(15)17/h2-9,14,21-22H,10-13H2,1H3,(H,23,24) |
| InChIKey | KATYCMPJSCGTHI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|