C21H25N3O — CID 109027527
N-(2,4-dimethylphenyl)-3-[2-(1H-indol-3-yl)ethylamino]propanamide (PubChem CID 109027527) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-3-[2-(1H-indol-3-yl)ethylamino]propanamide.
| Compound Name | N-(2,4-dimethylphenyl)-3-[2-(1H-indol-3-yl)ethylamino]propanamide |
|---|---|
| PubChem CID | 109027527 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | N-(2,4-dimethylphenyl)-3-[2-(1H-indol-3-yl)ethylamino]propanamide |
| SMILES | Cc1ccc(NC(=O)CCNCCc2c[nH]c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C21H25N3O/c1-15-7-8-19(16(2)13-15)24-21(25)10-12-22-11-9-17-14-23-20-6-4-3-5-18(17)20/h3-8,13-14,22-23H,9-12H2,1-2H3,(H,24,25) |
| InChIKey | LPDNHNJQQHSPCQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|