C19H20N2 — CID 144941300
N-[3-(1H-indol-3-yl)prop-1-en-2-yl]-2,4-dimethylaniline (PubChem CID 144941300) has the molecular formula C19H20N2 and a molecular weight of 276.38 g/mol. Its IUPAC name is N-[3-(1H-indol-3-yl)prop-1-en-2-yl]-2,4-dimethylaniline.
| Compound Name | N-[3-(1H-indol-3-yl)prop-1-en-2-yl]-2,4-dimethylaniline |
|---|---|
| PubChem CID | 144941300 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | N-[3-(1H-indol-3-yl)prop-1-en-2-yl]-2,4-dimethylaniline |
| SMILES | C=C(Cc1c[nH]c2ccccc12)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C19H20N2/c1-13-8-9-18(14(2)10-13)21-15(3)11-16-12-20-19-7-5-4-6-17(16)19/h4-10,12,20-21H,3,11H2,1-2H3 |
| InChIKey | FPVDFRXOLYOJSE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |