C21H25N3O — CID 109002334
2-[2-(1H-indol-3-yl)ethylamino]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 109002334) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-[2-(1H-indol-3-yl)ethylamino]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[2-(1H-indol-3-yl)ethylamino]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 109002334 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 2-[2-(1H-indol-3-yl)ethylamino]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CNCCc2c[nH]c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C21H25N3O/c1-14-10-15(2)21(16(3)11-14)24-20(25)13-22-9-8-17-12-23-19-7-5-4-6-18(17)19/h4-7,10-12,22-23H,8-9,13H2,1-3H3,(H,24,25) |
| InChIKey | HCURHPUGVBVMFD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|