C21H25N3O — CID 17066776
N-(2,6-dimethylphenyl)-2-[2-(5-methyl-1H-indol-3-yl)ethylamino]acetamide (PubChem CID 17066776) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[2-(5-methyl-1H-indol-3-yl)ethylamino]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[2-(5-methyl-1H-indol-3-yl)ethylamino]acetamide |
|---|---|
| PubChem CID | 17066776 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[2-(5-methyl-1H-indol-3-yl)ethylamino]acetamide |
| SMILES | Cc1ccc2[nH]cc(CCNCC(=O)Nc3c(C)cccc3C)c2c1 |
| InChI | InChI=1S/C21H25N3O/c1-14-7-8-19-18(11-14)17(12-23-19)9-10-22-13-20(25)24-21-15(2)5-4-6-16(21)3/h4-8,11-12,22-23H,9-10,13H2,1-3H3,(H,24,25) |
| InChIKey | NMTGBXXNBAJZIK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|