C19H25N5O — CID 50977958
N-(1-ethyl-3,5-dimethylpyrazol-4-yl)-2-[2-(1H-indol-3-yl)ethylamino]acetamide (PubChem CID 50977958) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is N-(1-ethyl-3,5-dimethylpyrazol-4-yl)-2-[2-(1H-indol-3-yl)ethylamino]acetamide.
| Compound Name | N-(1-ethyl-3,5-dimethylpyrazol-4-yl)-2-[2-(1H-indol-3-yl)ethylamino]acetamide |
|---|---|
| PubChem CID | 50977958 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | N-(1-ethyl-3,5-dimethylpyrazol-4-yl)-2-[2-(1H-indol-3-yl)ethylamino]acetamide |
| SMILES | CCn1nc(C)c(NC(=O)CNCCc2c[nH]c3ccccc23)c1C |
| InChI | InChI=1S/C19H25N5O/c1-4-24-14(3)19(13(2)23-24)22-18(25)12-20-10-9-15-11-21-17-8-6-5-7-16(15)17/h5-8,11,20-21H,4,9-10,12H2,1-3H3,(H,22,25) |
| InChIKey | DASXZBYIEYMFEC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|