C18H17Cl2N3O — CID 109002406
N-(3,5-dichlorophenyl)-2-[2-(1H-indol-3-yl)ethylamino]acetamide (PubChem CID 109002406) has the molecular formula C18H17Cl2N3O and a molecular weight of 362.26 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-[2-(1H-indol-3-yl)ethylamino]acetamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-[2-(1H-indol-3-yl)ethylamino]acetamide |
|---|---|
| PubChem CID | 109002406 |
| Molecular Formula | C18H17Cl2N3O |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-[2-(1H-indol-3-yl)ethylamino]acetamide |
| SMILES | O=C(CNCCc1c[nH]c2ccccc12)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H17Cl2N3O/c19-13-7-14(20)9-15(8-13)23-18(24)11-21-6-5-12-10-22-17-4-2-1-3-16(12)17/h1-4,7-10,21-22H,5-6,11H2,(H,23,24) |
| InChIKey | STMAKXGKKDYRGC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|