C19H18ClN3O2 — CID 112998163
N-[2-(3-chloro-4-methylanilino)-2-oxoethyl]-2-(1H-indol-3-yl)acetamide (PubChem CID 112998163) has the molecular formula C19H18ClN3O2 and a molecular weight of 355.83 g/mol. Its IUPAC name is N-[2-(3-chloro-4-methylanilino)-2-oxoethyl]-2-(1H-indol-3-yl)acetamide.
| Compound Name | N-[2-(3-chloro-4-methylanilino)-2-oxoethyl]-2-(1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 112998163 |
| Molecular Formula | C19H18ClN3O2 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | N-[2-(3-chloro-4-methylanilino)-2-oxoethyl]-2-(1H-indol-3-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)CNC(=O)Cc2c[nH]c3ccccc23)cc1Cl |
| InChI | InChI=1S/C19H18ClN3O2/c1-12-6-7-14(9-16(12)20)23-19(25)11-22-18(24)8-13-10-21-17-5-3-2-4-15(13)17/h2-7,9-10,21H,8,11H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | WKYOGNRMXIGNSR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |