C17H17N3O3S — CID 9140853
2-(1H-indol-3-yl)-N-(4-methyl-3-sulfamoylphenyl)acetamide (PubChem CID 9140853) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-(4-methyl-3-sulfamoylphenyl)acetamide.
| Compound Name | 2-(1H-indol-3-yl)-N-(4-methyl-3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 9140853 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-(4-methyl-3-sulfamoylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cc2c[nH]c3ccccc23)cc1S(N)(=O)=O |
| InChI | InChI=1S/C17H17N3O3S/c1-11-6-7-13(9-16(11)24(18,22)23)20-17(21)8-12-10-19-15-5-3-2-4-14(12)15/h2-7,9-10,19H,8H2,1H3,(H,20,21)(H2,18,22,23) |
| InChIKey | BXJHGAIOVSCYEE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |