C23H30N4O — CID 109002411
N-[4-(diethylamino)-2-methylphenyl]-2-[2-(1H-indol-3-yl)ethylamino]acetamide (PubChem CID 109002411) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-2-[2-(1H-indol-3-yl)ethylamino]acetamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-2-[2-(1H-indol-3-yl)ethylamino]acetamide |
|---|---|
| PubChem CID | 109002411 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-2-[2-(1H-indol-3-yl)ethylamino]acetamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CNCCc2c[nH]c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C23H30N4O/c1-4-27(5-2)19-10-11-21(17(3)14-19)26-23(28)16-24-13-12-18-15-25-22-9-7-6-8-20(18)22/h6-11,14-15,24-25H,4-5,12-13,16H2,1-3H3,(H,26,28) |
| InChIKey | AJJRYYCDIGEDGT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|