C23H29N3O — CID 113211503
N-[4-(diethylamino)-2-methylphenyl]-2-(1,2-dimethylindol-3-yl)acetamide (PubChem CID 113211503) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-2-(1,2-dimethylindol-3-yl)acetamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-2-(1,2-dimethylindol-3-yl)acetamide |
|---|---|
| PubChem CID | 113211503 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-2-(1,2-dimethylindol-3-yl)acetamide |
| SMILES | CCN(CC)c1ccc(NC(=O)Cc2c(C)n(C)c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C23H29N3O/c1-6-26(7-2)18-12-13-21(16(3)14-18)24-23(27)15-20-17(4)25(5)22-11-9-8-10-19(20)22/h8-14H,6-7,15H2,1-5H3,(H,24,27) |
| InChIKey | CROJEIYPDNCGPP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|