C22H24N2O3 — CID 8807940
[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl] 2,4,6-trimethylbenzoate (PubChem CID 8807940) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is [2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl] 2,4,6-trimethylbenzoate.
| Compound Name | [2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl] 2,4,6-trimethylbenzoate |
|---|---|
| PubChem CID | 8807940 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | [2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl] 2,4,6-trimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)OCC(=O)NCCc2c[nH]c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C22H24N2O3/c1-14-10-15(2)21(16(3)11-14)22(26)27-13-20(25)23-9-8-17-12-24-19-7-5-4-6-18(17)19/h4-7,10-12,24H,8-9,13H2,1-3H3,(H,23,25) |
| InChIKey | PTDMWYIENPWSHC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |