C20H23N3O — CID 43841967
2-amino-3-(1H-indol-3-yl)-N-(2,4,6-trimethylphenyl)propanamide (PubChem CID 43841967) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-amino-3-(1H-indol-3-yl)-N-(2,4,6-trimethylphenyl)propanamide.
| Compound Name | 2-amino-3-(1H-indol-3-yl)-N-(2,4,6-trimethylphenyl)propanamide |
|---|---|
| PubChem CID | 43841967 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 2-amino-3-(1H-indol-3-yl)-N-(2,4,6-trimethylphenyl)propanamide |
| SMILES | Cc1cc(C)c(NC(=O)C(N)Cc2c[nH]c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C20H23N3O/c1-12-8-13(2)19(14(3)9-12)23-20(24)17(21)10-15-11-22-18-7-5-4-6-16(15)18/h4-9,11,17,22H,10,21H2,1-3H3,(H,23,24) |
| InChIKey | FZMJMMMUXPRDQH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |