C17H24N4O3 — CID 91013760
5-[[(2R)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]pentylcarbamic acid (PubChem CID 91013760) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is 5-[[(2R)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]pentylcarbamic acid.
| Compound Name | 5-[[(2R)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]pentylcarbamic acid |
|---|---|
| PubChem CID | 91013760 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 5-[[(2R)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]pentylcarbamic acid |
| SMILES | N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCCCCNC(=O)O |
| InChI | InChI=1S/C17H24N4O3/c18-14(10-12-11-21-15-7-3-2-6-13(12)15)16(22)19-8-4-1-5-9-20-17(23)24/h2-3,6-7,11,14,20-21H,1,4-5,8-10,18H2,(H,19,22)(H,23,24)/t14-/m1/s1 |
| InChIKey | RZRGCVIUWSZDQS-CQSZACIVSA-N |
| XLogP | 1.59 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|