C25H37N3O5S — CID 67861543
5-[3-(3,5-dimethoxyphenyl)propylamino]-2-phenyl-2-propan-2-ylpentanenitrile;sulfamic acid (PubChem CID 67861543) has the molecular formula C25H37N3O5S and a molecular weight of 491.65 g/mol. Its IUPAC name is 5-[3-(3,5-dimethoxyphenyl)propylamino]-2-phenyl-2-propan-2-ylpentanenitrile;sulfamic acid.
| Compound Name | 5-[3-(3,5-dimethoxyphenyl)propylamino]-2-phenyl-2-propan-2-ylpentanenitrile;sulfamic acid |
|---|---|
| PubChem CID | 67861543 |
| Molecular Formula | C25H37N3O5S |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | 5-[3-(3,5-dimethoxyphenyl)propylamino]-2-phenyl-2-propan-2-ylpentanenitrile;sulfamic acid |
| SMILES | COc1cc(CCCNCCCC(C#N)(c2ccccc2)C(C)C)cc(OC)c1.NS(=O)(=O)O |
| InChI | InChI=1S/C25H34N2O2.H3NO3S/c1-20(2)25(19-26,22-11-6-5-7-12-22)13-9-15-27-14-8-10-21-16-23(28-3)18-24(17-21)29-4;1-5(2,3)4/h5-7,11-12,16-18,20,27H,8-10,13-15H2,1-4H3;(H3,1,2,3,4) |
| InChIKey | CNQXZBNYEVDEFG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 134.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|