C14H18BrN — CID 129363501
(2R)-5-bromo-2-phenyl-2-propan-2-ylpentanenitrile (PubChem CID 129363501) has the molecular formula C14H18BrN and a molecular weight of 280.21 g/mol. Its IUPAC name is (2R)-5-bromo-2-phenyl-2-propan-2-ylpentanenitrile.
| Compound Name | (2R)-5-bromo-2-phenyl-2-propan-2-ylpentanenitrile |
|---|---|
| PubChem CID | 129363501 |
| Molecular Formula | C14H18BrN |
| Molecular Weight | 280.21 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | (2R)-5-bromo-2-phenyl-2-propan-2-ylpentanenitrile |
| SMILES | CC(C)[C@](C#N)(CCCBr)c1ccccc1 |
| InChI | InChI=1S/C14H18BrN/c1-12(2)14(11-16,9-6-10-15)13-7-4-3-5-8-13/h3-5,7-8,12H,6,9-10H2,1-2H3/t14-/m1/s1 |
| InChIKey | MOBFAVLOQBFQIW-CQSZACIVSA-N |
| XLogP | 4.28 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.21 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|