C22H27BrN2 — CID 21181634
5-[benzyl(methyl)amino]-2-(4-bromophenyl)-2-propan-2-ylpentanenitrile (PubChem CID 21181634) has the molecular formula C22H27BrN2 and a molecular weight of 399.38 g/mol. Its IUPAC name is 5-[benzyl(methyl)amino]-2-(4-bromophenyl)-2-propan-2-ylpentanenitrile.
| Compound Name | 5-[benzyl(methyl)amino]-2-(4-bromophenyl)-2-propan-2-ylpentanenitrile |
|---|---|
| PubChem CID | 21181634 |
| Molecular Formula | C22H27BrN2 |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 5-[benzyl(methyl)amino]-2-(4-bromophenyl)-2-propan-2-ylpentanenitrile |
| SMILES | CC(C)C(C#N)(CCCN(C)Cc1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H27BrN2/c1-18(2)22(17-24,20-10-12-21(23)13-11-20)14-7-15-25(3)16-19-8-5-4-6-9-19/h4-6,8-13,18H,7,14-16H2,1-3H3 |
| InChIKey | FUXCISMTEUQRHD-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |