C31H37BrN2 — CID 70242256
5-[bis(1-phenylethyl)amino]-2-(4-bromophenyl)-2-propan-2-ylhexanenitrile (PubChem CID 70242256) has the molecular formula C31H37BrN2 and a molecular weight of 517.56 g/mol. Its IUPAC name is 5-[bis(1-phenylethyl)amino]-2-(4-bromophenyl)-2-propan-2-ylhexanenitrile.
| Compound Name | 5-[bis(1-phenylethyl)amino]-2-(4-bromophenyl)-2-propan-2-ylhexanenitrile |
|---|---|
| PubChem CID | 70242256 |
| Molecular Formula | C31H37BrN2 |
| Molecular Weight | 517.56 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | 5-[bis(1-phenylethyl)amino]-2-(4-bromophenyl)-2-propan-2-ylhexanenitrile |
| SMILES | CC(CCC(C#N)(c1ccc(Br)cc1)C(C)C)N(C(C)c1ccccc1)C(C)c1ccccc1 |
| InChI | InChI=1S/C31H37BrN2/c1-23(2)31(22-33,29-16-18-30(32)19-17-29)21-20-24(3)34(25(4)27-12-8-6-9-13-27)26(5)28-14-10-7-11-15-28/h6-19,23-26H,20-21H2,1-5H3 |
| InChIKey | HALARCTYMNZAIC-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.56 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |