C23H29BrN2 — CID 70243653
2-(2-bromophenyl)-5-[methyl(1-phenylethyl)amino]-2-propan-2-ylpentanenitrile (PubChem CID 70243653) has the molecular formula C23H29BrN2 and a molecular weight of 413.40 g/mol. Its IUPAC name is 2-(2-bromophenyl)-5-[methyl(1-phenylethyl)amino]-2-propan-2-ylpentanenitrile.
| Compound Name | 2-(2-bromophenyl)-5-[methyl(1-phenylethyl)amino]-2-propan-2-ylpentanenitrile |
|---|---|
| PubChem CID | 70243653 |
| Molecular Formula | C23H29BrN2 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 2-(2-bromophenyl)-5-[methyl(1-phenylethyl)amino]-2-propan-2-ylpentanenitrile |
| SMILES | CC(c1ccccc1)N(C)CCCC(C#N)(c1ccccc1Br)C(C)C |
| InChI | InChI=1S/C23H29BrN2/c1-18(2)23(17-25,21-13-8-9-14-22(21)24)15-10-16-26(4)19(3)20-11-6-5-7-12-20/h5-9,11-14,18-19H,10,15-16H2,1-4H3 |
| InChIKey | OCJIZDICYKVRAP-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |