C24H29F3N2 — CID 21181834
5-[benzyl(methyl)amino]-2-propan-2-yl-2-[2-(trifluoromethyl)phenyl]hexanenitrile (PubChem CID 21181834) has the molecular formula C24H29F3N2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 5-[benzyl(methyl)amino]-2-propan-2-yl-2-[2-(trifluoromethyl)phenyl]hexanenitrile.
| Compound Name | 5-[benzyl(methyl)amino]-2-propan-2-yl-2-[2-(trifluoromethyl)phenyl]hexanenitrile |
|---|---|
| PubChem CID | 21181834 |
| Molecular Formula | C24H29F3N2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 5-[benzyl(methyl)amino]-2-propan-2-yl-2-[2-(trifluoromethyl)phenyl]hexanenitrile |
| SMILES | CC(CCC(C#N)(c1ccccc1C(F)(F)F)C(C)C)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C24H29F3N2/c1-18(2)23(17-28,21-12-8-9-13-22(21)24(25,26)27)15-14-19(3)29(4)16-20-10-6-5-7-11-20/h5-13,18-19H,14-16H2,1-4H3 |
| InChIKey | HNAJYTMVBQEQSJ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |