C25H31F3N2 — CID 54293439
5-[benzyl(propan-2-yl)amino]-2-propan-2-yl-2-[2-(trifluoromethyl)phenyl]pentanenitrile (PubChem CID 54293439) has the molecular formula C25H31F3N2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 5-[benzyl(propan-2-yl)amino]-2-propan-2-yl-2-[2-(trifluoromethyl)phenyl]pentanenitrile.
| Compound Name | 5-[benzyl(propan-2-yl)amino]-2-propan-2-yl-2-[2-(trifluoromethyl)phenyl]pentanenitrile |
|---|---|
| PubChem CID | 54293439 |
| Molecular Formula | C25H31F3N2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 5-[benzyl(propan-2-yl)amino]-2-propan-2-yl-2-[2-(trifluoromethyl)phenyl]pentanenitrile |
| SMILES | CC(C)N(CCCC(C#N)(c1ccccc1C(F)(F)F)C(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C25H31F3N2/c1-19(2)24(18-29,22-13-8-9-14-23(22)25(26,27)28)15-10-16-30(20(3)4)17-21-11-6-5-7-12-21/h5-9,11-14,19-20H,10,15-17H2,1-4H3 |
| InChIKey | RZCZYAITWDORJO-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |