C26H33F3N2 — CID 21181067
5-[2-phenylethyl(propyl)amino]-2-propan-2-yl-2-[4-(trifluoromethyl)phenyl]pentanenitrile (PubChem CID 21181067) has the molecular formula C26H33F3N2 and a molecular weight of 430.56 g/mol. Its IUPAC name is 5-[2-phenylethyl(propyl)amino]-2-propan-2-yl-2-[4-(trifluoromethyl)phenyl]pentanenitrile.
| Compound Name | 5-[2-phenylethyl(propyl)amino]-2-propan-2-yl-2-[4-(trifluoromethyl)phenyl]pentanenitrile |
|---|---|
| PubChem CID | 21181067 |
| Molecular Formula | C26H33F3N2 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | 5-[2-phenylethyl(propyl)amino]-2-propan-2-yl-2-[4-(trifluoromethyl)phenyl]pentanenitrile |
| SMILES | CCCN(CCCC(C#N)(c1ccc(C(F)(F)F)cc1)C(C)C)CCc1ccccc1 |
| InChI | InChI=1S/C26H33F3N2/c1-4-17-31(19-15-22-9-6-5-7-10-22)18-8-16-25(20-30,21(2)3)23-11-13-24(14-12-23)26(27,28)29/h5-7,9-14,21H,4,8,15-19H2,1-3H3 |
| InChIKey | SVBJRHUFWZOTQP-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |