C30H39F3N2 — CID 21181710
2-cyclohexyl-5-[2-phenylethyl(propyl)amino]-2-[4-(trifluoromethyl)phenyl]hexanenitrile (PubChem CID 21181710) has the molecular formula C30H39F3N2 and a molecular weight of 484.65 g/mol. Its IUPAC name is 2-cyclohexyl-5-[2-phenylethyl(propyl)amino]-2-[4-(trifluoromethyl)phenyl]hexanenitrile.
| Compound Name | 2-cyclohexyl-5-[2-phenylethyl(propyl)amino]-2-[4-(trifluoromethyl)phenyl]hexanenitrile |
|---|---|
| PubChem CID | 21181710 |
| Molecular Formula | C30H39F3N2 |
| Molecular Weight | 484.65 g/mol |
| Exact Mass | 484.31 |
| IUPAC Name | 2-cyclohexyl-5-[2-phenylethyl(propyl)amino]-2-[4-(trifluoromethyl)phenyl]hexanenitrile |
| SMILES | CCCN(CCc1ccccc1)C(C)CCC(C#N)(c1ccc(C(F)(F)F)cc1)C1CCCCC1 |
| InChI | InChI=1S/C30H39F3N2/c1-3-21-35(22-19-25-10-6-4-7-11-25)24(2)18-20-29(23-34,26-12-8-5-9-13-26)27-14-16-28(17-15-27)30(31,32)33/h4,6-7,10-11,14-17,24,26H,3,5,8-9,12-13,18-22H2,1-2H3 |
| InChIKey | JDCQKYBONFJQEC-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.65 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |