C28H37FN2 — CID 21181150
2-cyclopentyl-5-[ethyl(2-phenylethyl)amino]-2-(4-fluorophenyl)heptanenitrile (PubChem CID 21181150) has the molecular formula C28H37FN2 and a molecular weight of 420.62 g/mol. Its IUPAC name is 2-cyclopentyl-5-[ethyl(2-phenylethyl)amino]-2-(4-fluorophenyl)heptanenitrile.
| Compound Name | 2-cyclopentyl-5-[ethyl(2-phenylethyl)amino]-2-(4-fluorophenyl)heptanenitrile |
|---|---|
| PubChem CID | 21181150 |
| Molecular Formula | C28H37FN2 |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | 2-cyclopentyl-5-[ethyl(2-phenylethyl)amino]-2-(4-fluorophenyl)heptanenitrile |
| SMILES | CCC(CCC(C#N)(c1ccc(F)cc1)C1CCCC1)N(CC)CCc1ccccc1 |
| InChI | InChI=1S/C28H37FN2/c1-3-27(31(4-2)21-19-23-10-6-5-7-11-23)18-20-28(22-30,24-12-8-9-13-24)25-14-16-26(29)17-15-25/h5-7,10-11,14-17,24,27H,3-4,8-9,12-13,18-21H2,1-2H3 |
| InChIKey | FRTWVUJKUMQMGQ-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |