C24H29FN2 — CID 21181243
5-[benzyl(methyl)amino]-2-cyclopropyl-2-(4-fluorophenyl)heptanenitrile (PubChem CID 21181243) has the molecular formula C24H29FN2 and a molecular weight of 364.51 g/mol. Its IUPAC name is 5-[benzyl(methyl)amino]-2-cyclopropyl-2-(4-fluorophenyl)heptanenitrile.
| Compound Name | 5-[benzyl(methyl)amino]-2-cyclopropyl-2-(4-fluorophenyl)heptanenitrile |
|---|---|
| PubChem CID | 21181243 |
| Molecular Formula | C24H29FN2 |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 5-[benzyl(methyl)amino]-2-cyclopropyl-2-(4-fluorophenyl)heptanenitrile |
| SMILES | CCC(CCC(C#N)(c1ccc(F)cc1)C1CC1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C24H29FN2/c1-3-23(27(2)17-19-7-5-4-6-8-19)15-16-24(18-26,20-9-10-20)21-11-13-22(25)14-12-21/h4-8,11-14,20,23H,3,9-10,15-17H2,1-2H3 |
| InChIKey | RSDKEFBAJWZWQY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |