C29H31BrN2 — CID 21181861
2-(4-bromophenyl)-2-cyclopropyl-5-(dibenzylamino)hexanenitrile (PubChem CID 21181861) has the molecular formula C29H31BrN2 and a molecular weight of 487.49 g/mol. Its IUPAC name is 2-(4-bromophenyl)-2-cyclopropyl-5-(dibenzylamino)hexanenitrile.
| Compound Name | 2-(4-bromophenyl)-2-cyclopropyl-5-(dibenzylamino)hexanenitrile |
|---|---|
| PubChem CID | 21181861 |
| Molecular Formula | C29H31BrN2 |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 2-(4-bromophenyl)-2-cyclopropyl-5-(dibenzylamino)hexanenitrile |
| SMILES | CC(CCC(C#N)(c1ccc(Br)cc1)C1CC1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H31BrN2/c1-23(18-19-29(22-31,26-12-13-26)27-14-16-28(30)17-15-27)32(20-24-8-4-2-5-9-24)21-25-10-6-3-7-11-25/h2-11,14-17,23,26H,12-13,18-21H2,1H3 |
| InChIKey | YOZAVAHBJRYCSB-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |