C30H33BrN2 — CID 21181044
2-(4-bromophenyl)-2-cyclobutyl-5-(dibenzylamino)hexanenitrile (PubChem CID 21181044) has the molecular formula C30H33BrN2 and a molecular weight of 501.51 g/mol. Its IUPAC name is 2-(4-bromophenyl)-2-cyclobutyl-5-(dibenzylamino)hexanenitrile.
| Compound Name | 2-(4-bromophenyl)-2-cyclobutyl-5-(dibenzylamino)hexanenitrile |
|---|---|
| PubChem CID | 21181044 |
| Molecular Formula | C30H33BrN2 |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 2-(4-bromophenyl)-2-cyclobutyl-5-(dibenzylamino)hexanenitrile |
| SMILES | CC(CCC(C#N)(c1ccc(Br)cc1)C1CCC1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C30H33BrN2/c1-24(33(21-25-9-4-2-5-10-25)22-26-11-6-3-7-12-26)19-20-30(23-32,27-13-8-14-27)28-15-17-29(31)18-16-28/h2-7,9-12,15-18,24,27H,8,13-14,19-22H2,1H3 |
| InChIKey | HPBJRTXJFJCXEK-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |