C26H33ClN2 — CID 21181374
5-[benzyl(methyl)amino]-2-(2-chlorophenyl)-2-cyclohexylhexanenitrile (PubChem CID 21181374) has the molecular formula C26H33ClN2 and a molecular weight of 409.02 g/mol. Its IUPAC name is 5-[benzyl(methyl)amino]-2-(2-chlorophenyl)-2-cyclohexylhexanenitrile.
| Compound Name | 5-[benzyl(methyl)amino]-2-(2-chlorophenyl)-2-cyclohexylhexanenitrile |
|---|---|
| PubChem CID | 21181374 |
| Molecular Formula | C26H33ClN2 |
| Molecular Weight | 409.02 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 5-[benzyl(methyl)amino]-2-(2-chlorophenyl)-2-cyclohexylhexanenitrile |
| SMILES | CC(CCC(C#N)(c1ccccc1Cl)C1CCCCC1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C26H33ClN2/c1-21(29(2)19-22-11-5-3-6-12-22)17-18-26(20-28,23-13-7-4-8-14-23)24-15-9-10-16-25(24)27/h3,5-6,9-12,15-16,21,23H,4,7-8,13-14,17-19H2,1-2H3 |
| InChIKey | PJVCIOPRXVNUSR-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.02 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |