C27H35FN2 — CID 21181199
2-cyclopentyl-5-[ethyl(2-phenylethyl)amino]-2-(4-fluorophenyl)hexanenitrile (PubChem CID 21181199) has the molecular formula C27H35FN2 and a molecular weight of 406.59 g/mol. Its IUPAC name is 2-cyclopentyl-5-[ethyl(2-phenylethyl)amino]-2-(4-fluorophenyl)hexanenitrile.
| Compound Name | 2-cyclopentyl-5-[ethyl(2-phenylethyl)amino]-2-(4-fluorophenyl)hexanenitrile |
|---|---|
| PubChem CID | 21181199 |
| Molecular Formula | C27H35FN2 |
| Molecular Weight | 406.59 g/mol |
| Exact Mass | 406.28 |
| IUPAC Name | 2-cyclopentyl-5-[ethyl(2-phenylethyl)amino]-2-(4-fluorophenyl)hexanenitrile |
| SMILES | CCN(CCc1ccccc1)C(C)CCC(C#N)(c1ccc(F)cc1)C1CCCC1 |
| InChI | InChI=1S/C27H35FN2/c1-3-30(20-18-23-9-5-4-6-10-23)22(2)17-19-27(21-29,24-11-7-8-12-24)25-13-15-26(28)16-14-25/h4-6,9-10,13-16,22,24H,3,7-8,11-12,17-20H2,1-2H3 |
| InChIKey | DLRHBXBNBCQVSR-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.59 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |