C15H21NO2 — CID 10800518
(2R,5R)-5,6-dihydroxy-2-phenyl-2-propan-2-ylhexanenitrile (PubChem CID 10800518) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is (2R,5R)-5,6-dihydroxy-2-phenyl-2-propan-2-ylhexanenitrile.
| Compound Name | (2R,5R)-5,6-dihydroxy-2-phenyl-2-propan-2-ylhexanenitrile |
|---|---|
| PubChem CID | 10800518 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (2R,5R)-5,6-dihydroxy-2-phenyl-2-propan-2-ylhexanenitrile |
| SMILES | CC(C)[C@](C#N)(CC[C@@H](O)CO)c1ccccc1 |
| InChI | InChI=1S/C15H21NO2/c1-12(2)15(11-16,9-8-14(18)10-17)13-6-4-3-5-7-13/h3-7,12,14,17-18H,8-10H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | AVFPYZYUJZRZMJ-HUUCEWRRSA-N |
| XLogP | 2.24 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |