C26H34BN3O — CID 163654273
CID 163654273 (PubChem CID 163654273) has the molecular formula C26H34BN3O and a molecular weight of 415.39 g/mol.
| Compound Name | CID 163654273 |
|---|---|
| PubChem CID | 163654273 |
| Molecular Formula | C26H34BN3O |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(OCCN2CCN(CCCC(C#N)(c3ccccc3)C(C)C)CC2)c1 |
| InChI | InChI=1S/C26H34BN3O/c1-22(2)26(21-28,23-8-4-3-5-9-23)12-7-13-29-14-16-30(17-15-29)18-19-31-25-11-6-10-24(27)20-25/h3-6,8-11,20,22H,7,12-19H2,1-2H3 |
| InChIKey | KVAAUKUYJOQUEW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 39.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|