C20H30N2O — CID 134112534
2-(4-methoxyphenyl)-5-piperidin-1-yl-2-propan-2-ylpentanenitrile (PubChem CID 134112534) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-5-piperidin-1-yl-2-propan-2-ylpentanenitrile.
| Compound Name | 2-(4-methoxyphenyl)-5-piperidin-1-yl-2-propan-2-ylpentanenitrile |
|---|---|
| PubChem CID | 134112534 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | 2-(4-methoxyphenyl)-5-piperidin-1-yl-2-propan-2-ylpentanenitrile |
| SMILES | COc1ccc(C(C#N)(CCCN2CCCCC2)C(C)C)cc1 |
| InChI | InChI=1S/C20H30N2O/c1-17(2)20(16-21,18-8-10-19(23-3)11-9-18)12-7-15-22-13-5-4-6-14-22/h8-11,17H,4-7,12-15H2,1-3H3 |
| InChIKey | GEYRNEDWTNWBAY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |