C31H37N3O2 — CID 70051548
N-[4-cyano-4-(4-methoxyphenyl)-5-methylhexyl]-2-(2,2-diphenylethylamino)acetamide (PubChem CID 70051548) has the molecular formula C31H37N3O2 and a molecular weight of 483.66 g/mol. Its IUPAC name is N-[4-cyano-4-(4-methoxyphenyl)-5-methylhexyl]-2-(2,2-diphenylethylamino)acetamide.
| Compound Name | N-[4-cyano-4-(4-methoxyphenyl)-5-methylhexyl]-2-(2,2-diphenylethylamino)acetamide |
|---|---|
| PubChem CID | 70051548 |
| Molecular Formula | C31H37N3O2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | N-[4-cyano-4-(4-methoxyphenyl)-5-methylhexyl]-2-(2,2-diphenylethylamino)acetamide |
| SMILES | COc1ccc(C(C#N)(CCCNC(=O)CNCC(c2ccccc2)c2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C31H37N3O2/c1-24(2)31(23-32,27-15-17-28(36-3)18-16-27)19-10-20-34-30(35)22-33-21-29(25-11-6-4-7-12-25)26-13-8-5-9-14-26/h4-9,11-18,24,29,33H,10,19-22H2,1-3H3,(H,34,35) |
| InChIKey | OLMXPFXOSRPSLT-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|