C33H41N3O2S — CID 70053578
(2S)-2-(benzhydrylamino)-N-[4-cyano-4-(4-methoxyphenyl)-5-methylhexyl]-4-methylsulfanylbutanamide (PubChem CID 70053578) has the molecular formula C33H41N3O2S and a molecular weight of 543.78 g/mol. Its IUPAC name is (2S)-2-(benzhydrylamino)-N-[4-cyano-4-(4-methoxyphenyl)-5-methylhexyl]-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-(benzhydrylamino)-N-[4-cyano-4-(4-methoxyphenyl)-5-methylhexyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 70053578 |
| Molecular Formula | C33H41N3O2S |
| Molecular Weight | 543.78 g/mol |
| Exact Mass | 543.29 |
| IUPAC Name | (2S)-2-(benzhydrylamino)-N-[4-cyano-4-(4-methoxyphenyl)-5-methylhexyl]-4-methylsulfanylbutanamide |
| SMILES | COc1ccc(C(C#N)(CCCNC(=O)[C@H](CCSC)NC(c2ccccc2)c2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C33H41N3O2S/c1-25(2)33(24-34,28-16-18-29(38-3)19-17-28)21-11-22-35-32(37)30(20-23-39-4)36-31(26-12-7-5-8-13-26)27-14-9-6-10-15-27/h5-10,12-19,25,30-31,36H,11,20-23H2,1-4H3,(H,35,37)/t30-,33?/m0/s1 |
| InChIKey | DDGLNBZVGHPERU-JKNLKRECSA-N |
| XLogP | 6.51 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.78 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|