C42H50N4O3 — CID 70050301
benzyl N-[(5S)-5-[(4-cyano-5-methyl-4-phenylhexyl)amino]-6-(2,2-diphenylethylamino)-6-oxohexyl]carbamate (PubChem CID 70050301) has the molecular formula C42H50N4O3 and a molecular weight of 658.89 g/mol. Its IUPAC name is benzyl N-[(5S)-5-[(4-cyano-5-methyl-4-phenylhexyl)amino]-6-(2,2-diphenylethylamino)-6-oxohexyl]carbamate.
| Compound Name | benzyl N-[(5S)-5-[(4-cyano-5-methyl-4-phenylhexyl)amino]-6-(2,2-diphenylethylamino)-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 70050301 |
| Molecular Formula | C42H50N4O3 |
| Molecular Weight | 658.89 g/mol |
| Exact Mass | 658.39 |
| IUPAC Name | benzyl N-[(5S)-5-[(4-cyano-5-methyl-4-phenylhexyl)amino]-6-(2,2-diphenylethylamino)-6-oxohexyl]carbamate |
| SMILES | CC(C)C(C#N)(CCCN[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)NCC(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H50N4O3/c1-33(2)42(32-43,37-24-13-6-14-25-37)27-17-29-44-39(26-15-16-28-45-41(48)49-31-34-18-7-3-8-19-34)40(47)46-30-38(35-20-9-4-10-21-35)36-22-11-5-12-23-36/h3-14,18-25,33,38-39,44H,15-17,26-31H2,1-2H3,(H,45,48)(H,46,47)/t39-,42?/m0/s1 |
| InChIKey | SLGUMYDAXWTGAY-NDOGSIMJSA-N |
| XLogP | 7.89 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.89 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|