C27H34FN3O2S — CID 22718374
2-[4-(4-cyano-5-methyl-4-phenylhexyl)piperazin-1-yl]ethyl (4-fluorophenyl)sulfanylformate (PubChem CID 22718374) has the molecular formula C27H34FN3O2S and a molecular weight of 483.65 g/mol. Its IUPAC name is 2-[4-(4-cyano-5-methyl-4-phenylhexyl)piperazin-1-yl]ethyl (4-fluorophenyl)sulfanylformate.
| Compound Name | 2-[4-(4-cyano-5-methyl-4-phenylhexyl)piperazin-1-yl]ethyl (4-fluorophenyl)sulfanylformate |
|---|---|
| PubChem CID | 22718374 |
| Molecular Formula | C27H34FN3O2S |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 2-[4-(4-cyano-5-methyl-4-phenylhexyl)piperazin-1-yl]ethyl (4-fluorophenyl)sulfanylformate |
| SMILES | CC(C)C(C#N)(CCCN1CCN(CCOC(=O)Sc2ccc(F)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C27H34FN3O2S/c1-22(2)27(21-29,23-7-4-3-5-8-23)13-6-14-30-15-17-31(18-16-30)19-20-33-26(32)34-25-11-9-24(28)10-12-25/h3-5,7-12,22H,6,13-20H2,1-2H3 |
| InChIKey | IPMNTVCIJNJGMD-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|