C14H20F2 — CID 116841304
4-tert-butyl-1-(1,1-difluoropropyl)-2-methylbenzene (PubChem CID 116841304) has the molecular formula C14H20F2 and a molecular weight of 226.31 g/mol. Its IUPAC name is 4-tert-butyl-1-(1,1-difluoropropyl)-2-methylbenzene.
| Compound Name | 4-tert-butyl-1-(1,1-difluoropropyl)-2-methylbenzene |
|---|---|
| PubChem CID | 116841304 |
| Molecular Formula | C14H20F2 |
| Molecular Weight | 226.31 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 4-tert-butyl-1-(1,1-difluoropropyl)-2-methylbenzene |
| SMILES | CCC(F)(F)c1ccc(C(C)(C)C)cc1C |
| InChI | InChI=1S/C14H20F2/c1-6-14(15,16)12-8-7-11(9-10(12)2)13(3,4)5/h7-9H,6H2,1-5H3 |
| InChIKey | DUIVMDMAGBJCCY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.31 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |