C9H5ClN2O — CID 131057727
5-(chloromethyl)-1,3-benzoxazole-2-carbonitrile (PubChem CID 131057727) has the molecular formula C9H5ClN2O and a molecular weight of 192.60 g/mol. Its IUPAC name is 5-(chloromethyl)-1,3-benzoxazole-2-carbonitrile.
| Compound Name | 5-(chloromethyl)-1,3-benzoxazole-2-carbonitrile |
|---|---|
| PubChem CID | 131057727 |
| Molecular Formula | C9H5ClN2O |
| Molecular Weight | 192.60 g/mol |
| Exact Mass | 192.01 |
| IUPAC Name | 5-(chloromethyl)-1,3-benzoxazole-2-carbonitrile |
| SMILES | N#Cc1nc2cc(CCl)ccc2o1 |
| InChI | InChI=1S/C9H5ClN2O/c10-4-6-1-2-8-7(3-6)12-9(5-11)13-8/h1-3H,4H2 |
| InChIKey | NYGCZYNUKDMAEW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.60 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|