C9H7N3O — CID 46908315
6-(methylamino)-1,3-benzoxazole-2-carbonitrile (PubChem CID 46908315) has the molecular formula C9H7N3O and a molecular weight of 173.17 g/mol. Its IUPAC name is 6-(methylamino)-1,3-benzoxazole-2-carbonitrile.
| Compound Name | 6-(methylamino)-1,3-benzoxazole-2-carbonitrile |
|---|---|
| PubChem CID | 46908315 |
| Molecular Formula | C9H7N3O |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 6-(methylamino)-1,3-benzoxazole-2-carbonitrile |
| SMILES | CNc1ccc2nc(C#N)oc2c1 |
| InChI | InChI=1S/C9H7N3O/c1-11-6-2-3-7-8(4-6)13-9(5-10)12-7/h2-4,11H,1H3 |
| InChIKey | RVPSNUNKPHFNRJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |