C8H3FN2O — CID 119083065
6-fluoro-1,3-benzoxazole-2-carbonitrile (PubChem CID 119083065) has the molecular formula C8H3FN2O and a molecular weight of 162.12 g/mol. Its IUPAC name is 6-fluoro-1,3-benzoxazole-2-carbonitrile.
| Compound Name | 6-fluoro-1,3-benzoxazole-2-carbonitrile |
|---|---|
| PubChem CID | 119083065 |
| Molecular Formula | C8H3FN2O |
| Molecular Weight | 162.12 g/mol |
| Exact Mass | 162.02 |
| IUPAC Name | 6-fluoro-1,3-benzoxazole-2-carbonitrile |
| SMILES | N#Cc1nc2ccc(F)cc2o1 |
| InChI | InChI=1S/C8H3FN2O/c9-5-1-2-6-7(3-5)12-8(4-10)11-6/h1-3H |
| InChIKey | AYBKKPSVXADPNJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.12 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |