C12H14FN3O — CID 175649082
6-fluoro-2-(4-methylpiperazin-1-yl)-1,3-benzoxazole (PubChem CID 175649082) has the molecular formula C12H14FN3O and a molecular weight of 235.26 g/mol. Its IUPAC name is 6-fluoro-2-(4-methylpiperazin-1-yl)-1,3-benzoxazole.
| Compound Name | 6-fluoro-2-(4-methylpiperazin-1-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 175649082 |
| Molecular Formula | C12H14FN3O |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 6-fluoro-2-(4-methylpiperazin-1-yl)-1,3-benzoxazole |
| SMILES | CN1CCN(c2nc3ccc(F)cc3o2)CC1 |
| InChI | InChI=1S/C12H14FN3O/c1-15-4-6-16(7-5-15)12-14-10-3-2-9(13)8-11(10)17-12/h2-3,8H,4-7H2,1H3 |
| InChIKey | ASLKZFKNLHCHCS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |