C17H15F2N3O — CID 163357218
6-fluoro-2-[4-(4-fluorophenyl)piperazin-1-yl]-1,3-benzoxazole (PubChem CID 163357218) has the molecular formula C17H15F2N3O and a molecular weight of 315.32 g/mol. Its IUPAC name is 6-fluoro-2-[4-(4-fluorophenyl)piperazin-1-yl]-1,3-benzoxazole.
| Compound Name | 6-fluoro-2-[4-(4-fluorophenyl)piperazin-1-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 163357218 |
| Molecular Formula | C17H15F2N3O |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 6-fluoro-2-[4-(4-fluorophenyl)piperazin-1-yl]-1,3-benzoxazole |
| SMILES | Fc1ccc(N2CCN(c3nc4ccc(F)cc4o3)CC2)cc1 |
| InChI | InChI=1S/C17H15F2N3O/c18-12-1-4-14(5-2-12)21-7-9-22(10-8-21)17-20-15-6-3-13(19)11-16(15)23-17/h1-6,11H,7-10H2 |
| InChIKey | ROOAEKJGTDTJJX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |