C17H16FN7O — CID 154853693
6-fluoro-2-[4-(9-methylpurin-6-yl)piperazin-1-yl]-1,3-benzoxazole (PubChem CID 154853693) has the molecular formula C17H16FN7O and a molecular weight of 353.36 g/mol. Its IUPAC name is 6-fluoro-2-[4-(9-methylpurin-6-yl)piperazin-1-yl]-1,3-benzoxazole.
| Compound Name | 6-fluoro-2-[4-(9-methylpurin-6-yl)piperazin-1-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 154853693 |
| Molecular Formula | C17H16FN7O |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 6-fluoro-2-[4-(9-methylpurin-6-yl)piperazin-1-yl]-1,3-benzoxazole |
| SMILES | Cn1cnc2c(N3CCN(c4nc5ccc(F)cc5o4)CC3)ncnc21 |
| InChI | InChI=1S/C17H16FN7O/c1-23-10-21-14-15(23)19-9-20-16(14)24-4-6-25(7-5-24)17-22-12-3-2-11(18)8-13(12)26-17/h2-3,8-10H,4-7H2,1H3 |
| InChIKey | GHVGPQXQDMRSCS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |