C12H12N2O4S — CID 57264662
3-[6-(methylamino)-1,3-benzoxazol-2-yl]-4-oxo-4-sulfanylbutanoic acid (PubChem CID 57264662) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is 3-[6-(methylamino)-1,3-benzoxazol-2-yl]-4-oxo-4-sulfanylbutanoic acid.
| Compound Name | 3-[6-(methylamino)-1,3-benzoxazol-2-yl]-4-oxo-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 57264662 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 3-[6-(methylamino)-1,3-benzoxazol-2-yl]-4-oxo-4-sulfanylbutanoic acid |
| SMILES | CNc1ccc2nc(C(CC(=O)O)C(=O)S)oc2c1 |
| InChI | InChI=1S/C12H12N2O4S/c1-13-6-2-3-8-9(4-6)18-11(14-8)7(12(17)19)5-10(15)16/h2-4,7,13H,5H2,1H3,(H,15,16)(H,17,19) |
| InChIKey | OKTYNLFWDANRIF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|