C11H8N2O6S — CID 57212759
3-(6-nitro-1,3-benzoxazol-2-yl)-4-oxo-4-sulfanylbutanoic acid (PubChem CID 57212759) has the molecular formula C11H8N2O6S and a molecular weight of 296.26 g/mol. Its IUPAC name is 3-(6-nitro-1,3-benzoxazol-2-yl)-4-oxo-4-sulfanylbutanoic acid.
| Compound Name | 3-(6-nitro-1,3-benzoxazol-2-yl)-4-oxo-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 57212759 |
| Molecular Formula | C11H8N2O6S |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 3-(6-nitro-1,3-benzoxazol-2-yl)-4-oxo-4-sulfanylbutanoic acid |
| SMILES | O=C(O)CC(C(=O)S)c1nc2ccc([N+](=O)[O-])cc2o1 |
| InChI | InChI=1S/C11H8N2O6S/c14-9(15)4-6(11(16)20)10-12-7-2-1-5(13(17)18)3-8(7)19-10/h1-3,6H,4H2,(H,14,15)(H,16,20) |
| InChIKey | ZCVOWLSLSZGAJM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 123.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|