C10H8ClN3O3 — CID 113464717
N-(2-chloroprop-2-enyl)-6-nitro-1,3-benzoxazol-2-amine (PubChem CID 113464717) has the molecular formula C10H8ClN3O3 and a molecular weight of 253.64 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)-6-nitro-1,3-benzoxazol-2-amine.
| Compound Name | N-(2-chloroprop-2-enyl)-6-nitro-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 113464717 |
| Molecular Formula | C10H8ClN3O3 |
| Molecular Weight | 253.64 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | N-(2-chloroprop-2-enyl)-6-nitro-1,3-benzoxazol-2-amine |
| SMILES | C=C(Cl)CNc1nc2ccc([N+](=O)[O-])cc2o1 |
| InChI | InChI=1S/C10H8ClN3O3/c1-6(11)5-12-10-13-8-3-2-7(14(15)16)4-9(8)17-10/h2-4H,1,5H2,(H,12,13) |
| InChIKey | GNTKOSFSLGHKGH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.64 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|