C27H47N3O3S2 — CID 173413325
2-(1,3-benzoxazol-2-yl)butanebis(thioic S-acid);bis(octan-1-amine) (PubChem CID 173413325) has the molecular formula C27H47N3O3S2 and a molecular weight of 525.83 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)butanebis(thioic S-acid);bis(octan-1-amine).
| Compound Name | 2-(1,3-benzoxazol-2-yl)butanebis(thioic S-acid);bis(octan-1-amine) |
|---|---|
| PubChem CID | 173413325 |
| Molecular Formula | C27H47N3O3S2 |
| Molecular Weight | 525.83 g/mol |
| Exact Mass | 525.31 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)butanebis(thioic S-acid);bis(octan-1-amine) |
| SMILES | CCCCCCCCN.CCCCCCCCN.O=C(S)CC(C(=O)S)c1nc2ccccc2o1 |
| InChI | InChI=1S/C11H9NO3S2.2C8H19N/c13-9(16)5-6(11(14)17)10-12-7-3-1-2-4-8(7)15-10;2*1-2-3-4-5-6-7-8-9/h1-4,6H,5H2,(H,13,16)(H,14,17);2*2-9H2,1H3 |
| InChIKey | IFUQNVHBKDMVAG-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.83 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|