C35H63N3O2S3 — CID 173399201
2-(1,3-benzothiazol-2-yl)butanebis(thioic S-acid);bis(N,N-dibutylbutan-1-amine) (PubChem CID 173399201) has the molecular formula C35H63N3O2S3 and a molecular weight of 654.11 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)butanebis(thioic S-acid);bis(N,N-dibutylbutan-1-amine).
| Compound Name | 2-(1,3-benzothiazol-2-yl)butanebis(thioic S-acid);bis(N,N-dibutylbutan-1-amine) |
|---|---|
| PubChem CID | 173399201 |
| Molecular Formula | C35H63N3O2S3 |
| Molecular Weight | 654.11 g/mol |
| Exact Mass | 653.41 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)butanebis(thioic S-acid);bis(N,N-dibutylbutan-1-amine) |
| SMILES | CCCCN(CCCC)CCCC.CCCCN(CCCC)CCCC.O=C(S)CC(C(=O)S)c1nc2ccccc2s1 |
| InChI | InChI=1S/2C12H27N.C11H9NO2S3/c2*1-4-7-10-13(11-8-5-2)12-9-6-3;13-9(15)5-6(11(14)16)10-12-7-3-1-2-4-8(7)17-10/h2*4-12H2,1-3H3;1-4,6H,5H2,(H,13,15)(H,14,16) |
| InChIKey | DKIXXHVVWIQVRZ-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 53.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.11 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|