C25H27N3O2S3 — CID 173357256
2-(1,3-benzothiazol-2-yl)butanebis(thioic S-acid);phenylmethanamine (PubChem CID 173357256) has the molecular formula C25H27N3O2S3 and a molecular weight of 497.71 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)butanebis(thioic S-acid);phenylmethanamine.
| Compound Name | 2-(1,3-benzothiazol-2-yl)butanebis(thioic S-acid);phenylmethanamine |
|---|---|
| PubChem CID | 173357256 |
| Molecular Formula | C25H27N3O2S3 |
| Molecular Weight | 497.71 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)butanebis(thioic S-acid);phenylmethanamine |
| SMILES | NCc1ccccc1.NCc1ccccc1.O=C(S)CC(C(=O)S)c1nc2ccccc2s1 |
| InChI | InChI=1S/C11H9NO2S3.2C7H9N/c13-9(15)5-6(11(14)16)10-12-7-3-1-2-4-8(7)17-10;2*8-6-7-4-2-1-3-5-7/h1-4,6H,5H2,(H,13,15)(H,14,16);2*1-5H,6,8H2 |
| InChIKey | BCHRLWFXWVXVQA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.71 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|